C10H12BFO5 — CID 145362809
2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetaldehyde;methanol (PubChem CID 145362809) has the molecular formula C10H12BFO5 and a molecular weight of 242.01 g/mol. Its IUPAC name is 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetaldehyde;methanol.
| Compound Name | 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetaldehyde;methanol |
|---|---|
| PubChem CID | 145362809 |
| Molecular Formula | C10H12BFO5 |
| Molecular Weight | 242.01 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 2-[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)oxy]acetaldehyde;methanol |
| SMILES | CO.O=CCOc1ccc2c(c1F)B(O)OC2 |
| InChI | InChI=1S/C9H8BFO4.CH4O/c11-9-7(14-4-3-12)2-1-6-5-15-10(13)8(6)9;1-2/h1-3,13H,4-5H2;2H,1H3 |
| InChIKey | KVRMPODIOPPTOI-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.01 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|