C19H16B2F2N2O8 — CID 142587859
(2S)-2,3-bis[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]propanoic acid (PubChem CID 142587859) has the molecular formula C19H16B2F2N2O8 and a molecular weight of 459.96 g/mol. Its IUPAC name is (2S)-2,3-bis[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]propanoic acid.
| Compound Name | (2S)-2,3-bis[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 142587859 |
| Molecular Formula | C19H16B2F2N2O8 |
| Molecular Weight | 459.96 g/mol |
| Exact Mass | 460.11 |
| IUPAC Name | (2S)-2,3-bis[(7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)amino]propanoic acid |
| SMILES | O=C(NC[C@H](NC(=O)c1ccc2c(c1F)B(O)OC2)C(=O)O)c1ccc2c(c1F)B(O)OC2 |
| InChI | InChI=1S/C19H16B2F2N2O8/c22-15-10(3-1-8-6-32-20(30)13(8)15)17(26)24-5-12(19(28)29)25-18(27)11-4-2-9-7-33-21(31)14(9)16(11)23/h1-4,12,30-31H,5-7H2,(H,24,26)(H,25,27)(H,28,29)/t12-/m0/s1 |
| InChIKey | WKRRJDCYDXEALH-LBPRGKRZSA-N |
| XLogP | -1.99 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.96 |
| LogP ≤ 5 | -1.99 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|