C13H13BF3NO5 — CID 145400184
2,2,2-trifluoroethyl 2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]acetate (PubChem CID 145400184) has the molecular formula C13H13BF3NO5 and a molecular weight of 331.06 g/mol. Its IUPAC name is 2,2,2-trifluoroethyl 2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]acetate.
| Compound Name | 2,2,2-trifluoroethyl 2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 145400184 |
| Molecular Formula | C13H13BF3NO5 |
| Molecular Weight | 331.06 g/mol |
| Exact Mass | 331.08 |
| IUPAC Name | 2,2,2-trifluoroethyl 2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]acetate |
| SMILES | Cc1c(C(=O)NCC(=O)OCC(F)(F)F)ccc2c1B(O)OC2 |
| InChI | InChI=1S/C13H13BF3NO5/c1-7-9(3-2-8-5-23-14(21)11(7)8)12(20)18-4-10(19)22-6-13(15,16)17/h2-3,21H,4-6H2,1H3,(H,18,20) |
| InChIKey | DCSGZYDMOOYCGA-UHFFFAOYSA-N |
| XLogP | 0.05 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.06 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|