C21H21BF3NO6 — CID 145400131
(3,4,5-trifluorophenyl)methyl (2S)-3-hydroxy-2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-methylbutanoate (PubChem CID 145400131) has the molecular formula C21H21BF3NO6 and a molecular weight of 451.21 g/mol. Its IUPAC name is (3,4,5-trifluorophenyl)methyl (2S)-3-hydroxy-2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-methylbutanoate.
| Compound Name | (3,4,5-trifluorophenyl)methyl (2S)-3-hydroxy-2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 145400131 |
| Molecular Formula | C21H21BF3NO6 |
| Molecular Weight | 451.21 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | (3,4,5-trifluorophenyl)methyl (2S)-3-hydroxy-2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]-3-methylbutanoate |
| SMILES | Cc1c(C(=O)N[C@H](C(=O)OCc2cc(F)c(F)c(F)c2)C(C)(C)O)ccc2c1B(O)OC2 |
| InChI | InChI=1S/C21H21BF3NO6/c1-10-13(5-4-12-9-32-22(30)16(10)12)19(27)26-18(21(2,3)29)20(28)31-8-11-6-14(23)17(25)15(24)7-11/h4-7,18,29-30H,8-9H2,1-3H3,(H,26,27)/t18-/m1/s1 |
| InChIKey | QLGRRNSUELEAFB-GOSISDBHSA-N |
| XLogP | 1.24 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.21 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|