C18H17BFNO5 — CID 145400243
(4-fluorophenyl)methyl 2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]acetate (PubChem CID 145400243) has the molecular formula C18H17BFNO5 and a molecular weight of 357.15 g/mol. Its IUPAC name is (4-fluorophenyl)methyl 2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]acetate.
| Compound Name | (4-fluorophenyl)methyl 2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 145400243 |
| Molecular Formula | C18H17BFNO5 |
| Molecular Weight | 357.15 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | (4-fluorophenyl)methyl 2-[(1-hydroxy-7-methyl-3H-2,1-benzoxaborole-6-carbonyl)amino]acetate |
| SMILES | Cc1c(C(=O)NCC(=O)OCc2ccc(F)cc2)ccc2c1B(O)OC2 |
| InChI | InChI=1S/C18H17BFNO5/c1-11-15(7-4-13-10-26-19(24)17(11)13)18(23)21-8-16(22)25-9-12-2-5-14(20)6-3-12/h2-7,24H,8-10H2,1H3,(H,21,23) |
| InChIKey | PRXFESDFDQSOFL-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.15 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|