C23H26B2N2O8 — CID 172528962
2,3-bis[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborole-7-carbonyl)amino]propanoic acid (PubChem CID 172528962) has the molecular formula C23H26B2N2O8 and a molecular weight of 480.09 g/mol. Its IUPAC name is 2,3-bis[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborole-7-carbonyl)amino]propanoic acid.
| Compound Name | 2,3-bis[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborole-7-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 172528962 |
| Molecular Formula | C23H26B2N2O8 |
| Molecular Weight | 480.09 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 2,3-bis[(1-hydroxy-3,3-dimethyl-2,1-benzoxaborole-7-carbonyl)amino]propanoic acid |
| SMILES | CC1(C)OB(O)c2c(C(=O)NCC(NC(=O)c3cccc4c3B(O)OC4(C)C)C(=O)O)cccc21 |
| InChI | InChI=1S/C23H26B2N2O8/c1-22(2)14-9-5-7-12(17(14)24(32)34-22)19(28)26-11-16(21(30)31)27-20(29)13-8-6-10-15-18(13)25(33)35-23(15,3)4/h5-10,16,32-33H,11H2,1-4H3,(H,26,28)(H,27,29)(H,30,31) |
| InChIKey | BIRFIAWRRNODQC-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 154.42 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.09 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|