C13H14N2O3 — CID 71223636
N-[(2R)-3-amino-2-methyl-3-oxopropyl]-1-benzofuran-4-carboxamide (PubChem CID 71223636) has the molecular formula C13H14N2O3 and a molecular weight of 246.27 g/mol. Its IUPAC name is N-[(2R)-3-amino-2-methyl-3-oxopropyl]-1-benzofuran-4-carboxamide.
| Compound Name | N-[(2R)-3-amino-2-methyl-3-oxopropyl]-1-benzofuran-4-carboxamide |
|---|---|
| PubChem CID | 71223636 |
| Molecular Formula | C13H14N2O3 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | N-[(2R)-3-amino-2-methyl-3-oxopropyl]-1-benzofuran-4-carboxamide |
| SMILES | C[C@H](CNC(=O)c1cccc2occc12)C(N)=O |
| InChI | InChI=1S/C13H14N2O3/c1-8(12(14)16)7-15-13(17)10-3-2-4-11-9(10)5-6-18-11/h2-6,8H,7H2,1H3,(H2,14,16)(H,15,17)/t8-/m1/s1 |
| InChIKey | MACLACTYYZKLOL-MRVPVSSYSA-N |
| XLogP | 1.28 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |