About 1-benzofuran-4-carbonyl chloride
1-benzofuran-4-carbonyl chloride (PubChem CID 23450130) has the molecular formula C9H5ClO2
and a molecular weight of 180.59 g/mol. Its IUPAC name is 1-benzofuran-4-carbonyl chloride.
Molecular Properties
| Compound Name | 1-benzofuran-4-carbonyl chloride |
| PubChem CID | 23450130 |
| Molecular Formula | C9H5ClO2 |
| Molecular Weight | 180.59 g/mol |
| Exact Mass | 180.00 |
| IUPAC Name | 1-benzofuran-4-carbonyl chloride |
| SMILES | O=C(Cl)c1cccc2occc12 |
| InChI | InChI=1S/C9H5ClO2/c10-9(11)7-2-1-3-8-6(7)4-5-12-8/h1-5H |
| InChIKey | LKRFEKDIARVXQR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-4-carbonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-4-carbonyl chloride?
The IUPAC name of 1-benzofuran-4-carbonyl chloride (CID 23450130) is 1-benzofuran-4-carbonyl chloride.
What is the SMILES notation for 1-benzofuran-4-carbonyl chloride?
The canonical SMILES for 1-benzofuran-4-carbonyl chloride is O=C(Cl)c1cccc2occc12.
What is the InChIKey of 1-benzofuran-4-carbonyl chloride?
The InChIKey is LKRFEKDIARVXQR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5ClO2/c10-9(11)7-2-1-3-8-6(7)4-5-12-8/h1-5H.
What are the key properties of 1-benzofuran-4-carbonyl chloride?
1-benzofuran-4-carbonyl chloride has a molecular weight of 180.59 g/mol, XLogP of 2.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-4-carbonyl chloride is sourced from PubChem (CID 23450130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).