About azane;chromen-4-one
azane;chromen-4-one (PubChem CID 175189895) has the molecular formula C9H9NO2
and a molecular weight of 163.18 g/mol. Its IUPAC name is azane;chromen-4-one.
Molecular Properties
| Compound Name | azane;chromen-4-one |
| PubChem CID | 175189895 |
| Molecular Formula | C9H9NO2 |
| Molecular Weight | 163.18 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | azane;chromen-4-one |
| SMILES | N.O=c1ccoc2ccccc12 |
| InChI | InChI=1S/C9H6O2.H3N/c10-8-5-6-11-9-4-2-1-3-7(8)9;/h1-6H;1H3 |
| InChIKey | KHXQRJPZYKIAAS-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.18 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;chromen-4-one?
The IUPAC name of azane;chromen-4-one (CID 175189895) is azane;chromen-4-one.
What is the SMILES notation for azane;chromen-4-one?
The canonical SMILES for azane;chromen-4-one is N.O=c1ccoc2ccccc12.
What is the InChIKey of azane;chromen-4-one?
The InChIKey is KHXQRJPZYKIAAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6O2.H3N/c10-8-5-6-11-9-4-2-1-3-7(8)9;/h1-6H;1H3.
What are the key properties of azane;chromen-4-one?
azane;chromen-4-one has a molecular weight of 163.18 g/mol, XLogP of 1.96, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;chromen-4-one is sourced from PubChem (CID 175189895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).