About acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one
acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one (PubChem CID 158135301) has the molecular formula C23H16N2O4
and a molecular weight of 384.39 g/mol. Its IUPAC name is acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one.
Molecular Properties
| Compound Name | acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one |
| PubChem CID | 158135301 |
| Molecular Formula | C23H16N2O4 |
| Molecular Weight | 384.39 g/mol |
| Exact Mass | 384.11 |
| IUPAC Name | acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one |
| SMILES | CC#N.O=c1c2ccccc2oc2cccnc12.O=c1ccoc2ccccc12 |
| InChI | InChI=1S/C12H7NO2.C9H6O2.C2H3N/c14-12-8-4-1-2-5-9(8)15-10-6-3-7-13-11(10)12;10-8-5-6-11-9-4-2-1-3-7(8)9;1-2-3/h1-7H;1-6H;1H3 |
| InChIKey | FTGRMJKOCZJUCL-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 97.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 384.39 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one?
The IUPAC name of acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one (CID 158135301) is acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one.
What is the SMILES notation for acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one?
The canonical SMILES for acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one is CC#N.O=c1c2ccccc2oc2cccnc12.O=c1ccoc2ccccc12.
What is the InChIKey of acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one?
The InChIKey is FTGRMJKOCZJUCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO2.C9H6O2.C2H3N/c14-12-8-4-1-2-5-9(8)15-10-6-3-7-13-11(10)12;10-8-5-6-11-9-4-2-1-3-7(8)9;1-2-3/h1-7H;1-6H;1H3.
What are the key properties of acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one?
acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one has a molecular weight of 384.39 g/mol, XLogP of 4.66, 0 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;chromeno[3,2-b]pyridin-10-one;chromen-4-one is sourced from PubChem (CID 158135301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).