About chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one
chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one (PubChem CID 158624582) has the molecular formula C22H14Cl3NO5
and a molecular weight of 478.72 g/mol. Its IUPAC name is chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one.
Molecular Properties
| Compound Name | chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one |
| PubChem CID | 158624582 |
| Molecular Formula | C22H14Cl3NO5 |
| Molecular Weight | 478.72 g/mol |
| Exact Mass | 476.99 |
| IUPAC Name | chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one |
| SMILES | ClC(Cl)Cl.O=c1c2ccccc2oc2cc(O)cnc12.O=c1ccoc2ccccc12 |
| InChI | InChI=1S/C12H7NO3.C9H6O2.CHCl3/c14-7-5-10-11(13-6-7)12(15)8-3-1-2-4-9(8)16-10;10-8-5-6-11-9-4-2-1-3-7(8)9;2-1(3)4/h1-6,14H;1-6H;1H |
| InChIKey | HYKUEHIUHYIUML-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 93.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.72 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one?
The IUPAC name of chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one (CID 158624582) is chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one.
What is the SMILES notation for chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one?
The canonical SMILES for chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one is ClC(Cl)Cl.O=c1c2ccccc2oc2cc(O)cnc12.O=c1ccoc2ccccc12.
What is the InChIKey of chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one?
The InChIKey is HYKUEHIUHYIUML-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7NO3.C9H6O2.CHCl3/c14-7-5-10-11(13-6-7)12(15)8-3-1-2-4-9(8)16-10;10-8-5-6-11-9-4-2-1-3-7(8)9;2-1(3)4/h1-6,14H;1-6H;1H.
What are the key properties of chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one?
chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one has a molecular weight of 478.72 g/mol, XLogP of 5.83, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for chloroform;chromen-4-one;3-hydroxychromeno[3,2-b]pyridin-10-one is sourced from PubChem (CID 158624582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).