C12H9NO — CID 118331307
3-methyl-[1]benzofuro[3,2-b]pyridine (PubChem CID 118331307) has the molecular formula C12H9NO and a molecular weight of 183.21 g/mol. Its IUPAC name is 3-methyl-[1]benzofuro[3,2-b]pyridine.
| Compound Name | 3-methyl-[1]benzofuro[3,2-b]pyridine |
|---|---|
| PubChem CID | 118331307 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 3-methyl-[1]benzofuro[3,2-b]pyridine |
| SMILES | Cc1cnc2c(c1)oc1ccccc12 |
| InChI | InChI=1S/C12H9NO/c1-8-6-11-12(13-7-8)9-4-2-3-5-10(9)14-11/h2-7H,1H3 |
| InChIKey | BNTOOBLZSYNDJZ-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |