C19H15NO — CID 140577687
3-(3,5-dimethylphenyl)-[1]benzofuro[2,3-c]pyridine (PubChem CID 140577687) has the molecular formula C19H15NO and a molecular weight of 273.33 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-[1]benzofuro[2,3-c]pyridine.
| Compound Name | 3-(3,5-dimethylphenyl)-[1]benzofuro[2,3-c]pyridine |
|---|---|
| PubChem CID | 140577687 |
| Molecular Formula | C19H15NO |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-[1]benzofuro[2,3-c]pyridine |
| SMILES | Cc1cc(C)cc(-c2cc3c(cn2)oc2ccccc23)c1 |
| InChI | InChI=1S/C19H15NO/c1-12-7-13(2)9-14(8-12)17-10-16-15-5-3-4-6-18(15)21-19(16)11-20-17/h3-11H,1-2H3 |
| InChIKey | GMEULRMXMSRECH-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |