C17H10FNOS — CID 67326004
3-([1]benzofuro[2,3-c]pyridin-3-yl)-2-fluorobenzenethiol (PubChem CID 67326004) has the molecular formula C17H10FNOS and a molecular weight of 295.34 g/mol. Its IUPAC name is 3-([1]benzofuro[2,3-c]pyridin-3-yl)-2-fluorobenzenethiol.
| Compound Name | 3-([1]benzofuro[2,3-c]pyridin-3-yl)-2-fluorobenzenethiol |
|---|---|
| PubChem CID | 67326004 |
| Molecular Formula | C17H10FNOS |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.05 |
| IUPAC Name | 3-([1]benzofuro[2,3-c]pyridin-3-yl)-2-fluorobenzenethiol |
| SMILES | Fc1c(S)cccc1-c1cc2c(cn1)oc1ccccc12 |
| InChI | InChI=1S/C17H10FNOS/c18-17-11(5-3-7-16(17)21)13-8-12-10-4-1-2-6-14(10)20-15(12)9-19-13/h1-9,21H |
| InChIKey | JHLUHCUWMUZGCD-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 26.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|