C29H26FNO — CID 170047501
2-dibenzofuran-4-yl-5-[4-fluoro-3,5-di(propan-2-yl)phenyl]pyridine (PubChem CID 170047501) has the molecular formula C29H26FNO and a molecular weight of 423.53 g/mol. Its IUPAC name is 2-dibenzofuran-4-yl-5-[4-fluoro-3,5-di(propan-2-yl)phenyl]pyridine.
| Compound Name | 2-dibenzofuran-4-yl-5-[4-fluoro-3,5-di(propan-2-yl)phenyl]pyridine |
|---|---|
| PubChem CID | 170047501 |
| Molecular Formula | C29H26FNO |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 2-dibenzofuran-4-yl-5-[4-fluoro-3,5-di(propan-2-yl)phenyl]pyridine |
| SMILES | CC(C)c1cc(-c2ccc(-c3cccc4c3oc3ccccc34)nc2)cc(C(C)C)c1F |
| InChI | InChI=1S/C29H26FNO/c1-17(2)24-14-20(15-25(18(3)4)28(24)30)19-12-13-26(31-16-19)23-10-7-9-22-21-8-5-6-11-27(21)32-29(22)23/h5-18H,1-4H3 |
| InChIKey | LFADBGWTTJXWMK-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |