C28H25NO — CID 166573825
5-methyl-2-[7-(4-methylphenyl)dibenzofuran-4-yl]-4-propan-2-ylpyridine (PubChem CID 166573825) has the molecular formula C28H25NO and a molecular weight of 391.51 g/mol. Its IUPAC name is 5-methyl-2-[7-(4-methylphenyl)dibenzofuran-4-yl]-4-propan-2-ylpyridine.
| Compound Name | 5-methyl-2-[7-(4-methylphenyl)dibenzofuran-4-yl]-4-propan-2-ylpyridine |
|---|---|
| PubChem CID | 166573825 |
| Molecular Formula | C28H25NO |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 5-methyl-2-[7-(4-methylphenyl)dibenzofuran-4-yl]-4-propan-2-ylpyridine |
| SMILES | Cc1ccc(-c2ccc3c(c2)oc2c(-c4cc(C(C)C)c(C)cn4)cccc23)cc1 |
| InChI | InChI=1S/C28H25NO/c1-17(2)25-15-26(29-16-19(25)4)24-7-5-6-23-22-13-12-21(14-27(22)30-28(23)24)20-10-8-18(3)9-11-20/h5-17H,1-4H3 |
| InChIKey | RHBBHYUSPKQBHV-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |