C24H17NO — CID 166573759
2-(7-phenyldibenzofuran-4-yl)-4-(trideuteriomethyl)pyridine (PubChem CID 166573759) has the molecular formula C24H17NO and a molecular weight of 338.42 g/mol. Its IUPAC name is 2-(7-phenyldibenzofuran-4-yl)-4-(trideuteriomethyl)pyridine.
| Compound Name | 2-(7-phenyldibenzofuran-4-yl)-4-(trideuteriomethyl)pyridine |
|---|---|
| PubChem CID | 166573759 |
| Molecular Formula | C24H17NO |
| Molecular Weight | 338.42 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 2-(7-phenyldibenzofuran-4-yl)-4-(trideuteriomethyl)pyridine |
| SMILES | [2H]C([2H])([2H])c1ccnc(-c2cccc3c2oc2cc(-c4ccccc4)ccc23)c1 |
| InChI | InChI=1S/C24H17NO/c1-16-12-13-25-22(14-16)21-9-5-8-20-19-11-10-18(15-23(19)26-24(20)21)17-6-3-2-4-7-17/h2-15H,1H3/i1D3 |
| InChIKey | DAZPHKRGRRCYRL-FIBGUPNXSA-N |
| XLogP | 6.62 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.42 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |