C30H27NO — CID 155611017
4-[cyclohexyl(dideuterio)methyl]-2-(7-phenyldibenzofuran-4-yl)pyridine (PubChem CID 155611017) has the molecular formula C30H27NO and a molecular weight of 419.56 g/mol. Its IUPAC name is 4-[cyclohexyl(dideuterio)methyl]-2-(7-phenyldibenzofuran-4-yl)pyridine.
| Compound Name | 4-[cyclohexyl(dideuterio)methyl]-2-(7-phenyldibenzofuran-4-yl)pyridine |
|---|---|
| PubChem CID | 155611017 |
| Molecular Formula | C30H27NO |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 4-[cyclohexyl(dideuterio)methyl]-2-(7-phenyldibenzofuran-4-yl)pyridine |
| SMILES | [2H]C([2H])(c1ccnc(-c2cccc3c2oc2cc(-c4ccccc4)ccc23)c1)C1CCCCC1 |
| InChI | InChI=1S/C30H27NO/c1-3-8-21(9-4-1)18-22-16-17-31-28(19-22)27-13-7-12-26-25-15-14-24(20-29(25)32-30(26)27)23-10-5-2-6-11-23/h2,5-7,10-17,19-21H,1,3-4,8-9,18H2/i18D2 |
| InChIKey | ILEJBUJWIZQEHW-CPLZMPMBSA-N |
| XLogP | 8.44 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 8.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |