C32H31NO — CID 162709860
4-[cyclopentyl(dideuterio)methyl]-2-[1-(2-phenylpropan-2-yl)dibenzofuran-4-yl]pyridine (PubChem CID 162709860) has the molecular formula C32H31NO and a molecular weight of 447.62 g/mol. Its IUPAC name is 4-[cyclopentyl(dideuterio)methyl]-2-[1-(2-phenylpropan-2-yl)dibenzofuran-4-yl]pyridine.
| Compound Name | 4-[cyclopentyl(dideuterio)methyl]-2-[1-(2-phenylpropan-2-yl)dibenzofuran-4-yl]pyridine |
|---|---|
| PubChem CID | 162709860 |
| Molecular Formula | C32H31NO |
| Molecular Weight | 447.62 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | 4-[cyclopentyl(dideuterio)methyl]-2-[1-(2-phenylpropan-2-yl)dibenzofuran-4-yl]pyridine |
| SMILES | [2H]C([2H])(c1ccnc(-c2ccc(C(C)(C)c3ccccc3)c3c2oc2ccccc23)c1)C1CCCC1 |
| InChI | InChI=1S/C32H31NO/c1-32(2,24-12-4-3-5-13-24)27-17-16-25(31-30(27)26-14-8-9-15-29(26)34-31)28-21-23(18-19-33-28)20-22-10-6-7-11-22/h3-5,8-9,12-19,21-22H,6-7,10-11,20H2,1-2H3/i20D2 |
| InChIKey | XGVLGZIITOSFEF-FCLBBQIASA-N |
| XLogP | 8.71 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.62 |
| LogP ≤ 5 | 8.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |