C21H18BrNO — CID 164796614
2-(1-bromodibenzofuran-4-yl)-4-tert-butylpyridine (PubChem CID 164796614) has the molecular formula C21H18BrNO and a molecular weight of 380.29 g/mol. Its IUPAC name is 2-(1-bromodibenzofuran-4-yl)-4-tert-butylpyridine.
| Compound Name | 2-(1-bromodibenzofuran-4-yl)-4-tert-butylpyridine |
|---|---|
| PubChem CID | 164796614 |
| Molecular Formula | C21H18BrNO |
| Molecular Weight | 380.29 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | 2-(1-bromodibenzofuran-4-yl)-4-tert-butylpyridine |
| SMILES | CC(C)(C)c1ccnc(-c2ccc(Br)c3c2oc2ccccc23)c1 |
| InChI | InChI=1S/C21H18BrNO/c1-21(2,3)13-10-11-23-17(12-13)14-8-9-16(22)19-15-6-4-5-7-18(15)24-20(14)19/h4-12H,1-3H3 |
| InChIKey | CDNMSHYGFUQISE-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.29 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |