C22H21NO2 — CID 155386640
4-tert-butyl-2-(2-methoxydibenzofuran-4-yl)pyridine (PubChem CID 155386640) has the molecular formula C22H21NO2 and a molecular weight of 331.42 g/mol. Its IUPAC name is 4-tert-butyl-2-(2-methoxydibenzofuran-4-yl)pyridine.
| Compound Name | 4-tert-butyl-2-(2-methoxydibenzofuran-4-yl)pyridine |
|---|---|
| PubChem CID | 155386640 |
| Molecular Formula | C22H21NO2 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | 4-tert-butyl-2-(2-methoxydibenzofuran-4-yl)pyridine |
| SMILES | COc1cc(-c2cc(C(C)(C)C)ccn2)c2oc3ccccc3c2c1 |
| InChI | InChI=1S/C22H21NO2/c1-22(2,3)14-9-10-23-19(11-14)18-13-15(24-4)12-17-16-7-5-6-8-20(16)25-21(17)18/h5-13H,1-4H3 |
| InChIKey | NBNGKYPMWJHSHF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |