C35H39NO — CID 166575883
4-tert-butyl-2-[6-(3,5-ditert-butylphenyl)dibenzofuran-3-yl]pyridine (PubChem CID 166575883) has the molecular formula C35H39NO and a molecular weight of 489.70 g/mol. Its IUPAC name is 4-tert-butyl-2-[6-(3,5-ditert-butylphenyl)dibenzofuran-3-yl]pyridine.
| Compound Name | 4-tert-butyl-2-[6-(3,5-ditert-butylphenyl)dibenzofuran-3-yl]pyridine |
|---|---|
| PubChem CID | 166575883 |
| Molecular Formula | C35H39NO |
| Molecular Weight | 489.70 g/mol |
| Exact Mass | 489.30 |
| IUPAC Name | 4-tert-butyl-2-[6-(3,5-ditert-butylphenyl)dibenzofuran-3-yl]pyridine |
| SMILES | CC(C)(C)c1cc(-c2cccc3c2oc2cc(-c4cc(C(C)(C)C)ccn4)ccc23)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C35H39NO/c1-33(2,3)24-15-16-36-30(21-24)22-13-14-28-29-12-10-11-27(32(29)37-31(28)19-22)23-17-25(34(4,5)6)20-26(18-23)35(7,8)9/h10-21H,1-9H3 |
| InChIKey | PRLFQDPMNVRWHS-UHFFFAOYSA-N |
| XLogP | 10.21 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.70 |
| LogP ≤ 5 | 10.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |