C35H30N2O — CID 169301818
9-[6-(4-tert-butyl-2-pyridinyl)dibenzofuran-3-yl]-1,8-dimethylcarbazole (PubChem CID 169301818) has the molecular formula C35H30N2O and a molecular weight of 494.64 g/mol. Its IUPAC name is 9-[6-(4-tert-butyl-2-pyridinyl)dibenzofuran-3-yl]-1,8-dimethylcarbazole.
| Compound Name | 9-[6-(4-tert-butyl-2-pyridinyl)dibenzofuran-3-yl]-1,8-dimethylcarbazole |
|---|---|
| PubChem CID | 169301818 |
| Molecular Formula | C35H30N2O |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.24 |
| IUPAC Name | 9-[6-(4-tert-butyl-2-pyridinyl)dibenzofuran-3-yl]-1,8-dimethylcarbazole |
| SMILES | Cc1cccc2c3cccc(C)c3n(-c3ccc4c(c3)oc3c(-c5cc(C(C)(C)C)ccn5)cccc34)c12 |
| InChI | InChI=1S/C35H30N2O/c1-21-9-6-11-26-27-12-7-10-22(2)33(27)37(32(21)26)24-15-16-25-28-13-8-14-29(34(28)38-31(25)20-24)30-19-23(17-18-36-30)35(3,4)5/h6-20H,1-5H3 |
| InChIKey | ODKBWOKHRUEULH-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 30.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |