C36H32BNO2 — CID 169301862
4-tert-butyl-2-[14-(2,4,6-trimethylphenyl)-10,21-dioxa-14-borapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-8-yl]pyridine (PubChem CID 169301862) has the molecular formula C36H32BNO2 and a molecular weight of 521.47 g/mol. Its IUPAC name is 4-tert-butyl-2-[14-(2,4,6-trimethylphenyl)-10,21-dioxa-14-borapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-8-yl]pyridine.
| Compound Name | 4-tert-butyl-2-[14-(2,4,6-trimethylphenyl)-10,21-dioxa-14-borapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-8-yl]pyridine |
|---|---|
| PubChem CID | 169301862 |
| Molecular Formula | C36H32BNO2 |
| Molecular Weight | 521.47 g/mol |
| Exact Mass | 521.25 |
| IUPAC Name | 4-tert-butyl-2-[14-(2,4,6-trimethylphenyl)-10,21-dioxa-14-borapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1,3(11),4(9),5,7,12,15,17,19-nonaen-8-yl]pyridine |
| SMILES | Cc1cc(C)c(B2c3ccccc3Oc3cc4c(cc32)oc2c(-c3cc(C(C)(C)C)ccn3)cccc24)c(C)c1 |
| InChI | InChI=1S/C36H32BNO2/c1-21-16-22(2)34(23(3)17-21)37-28-12-7-8-13-31(28)39-33-19-27-25-10-9-11-26(35(25)40-32(27)20-29(33)37)30-18-24(14-15-38-30)36(4,5)6/h7-20H,1-6H3 |
| InChIKey | ZAUQKMKJUWQQHV-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.47 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|