C24H26N2O — CID 155611964
2-tert-butyl-8-[4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine (PubChem CID 155611964) has the molecular formula C24H26N2O and a molecular weight of 367.54 g/mol. Its IUPAC name is 2-tert-butyl-8-[4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine.
| Compound Name | 2-tert-butyl-8-[4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine |
|---|---|
| PubChem CID | 155611964 |
| Molecular Formula | C24H26N2O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 2-tert-butyl-8-[4-[1,1,1,3,3,3-hexadeuterio-2-(trideuteriomethyl)propan-2-yl]-2-pyridinyl]-[1]benzofuro[2,3-b]pyridine |
| SMILES | [2H]C([2H])([2H])C(c1ccnc(-c2cccc3c2oc2nc(C(C)(C)C)ccc23)c1)(C([2H])([2H])[2H])C([2H])([2H])[2H] |
| InChI | InChI=1S/C24H26N2O/c1-23(2,3)15-12-13-25-19(14-15)18-9-7-8-16-17-10-11-20(24(4,5)6)26-22(17)27-21(16)18/h7-14H,1-6H3/i1D3,2D3,3D3 |
| InChIKey | DJOWCFLGKXZJGZ-GQALSZNTSA-N |
| XLogP | 6.64 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |