C34H26N2O — CID 170546327
4-[4-[6-(4-tert-butyl-2-pyridinyl)dibenzofuran-4-yl]phenyl]benzonitrile (PubChem CID 170546327) has the molecular formula C34H26N2O and a molecular weight of 478.60 g/mol. Its IUPAC name is 4-[4-[6-(4-tert-butyl-2-pyridinyl)dibenzofuran-4-yl]phenyl]benzonitrile.
| Compound Name | 4-[4-[6-(4-tert-butyl-2-pyridinyl)dibenzofuran-4-yl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 170546327 |
| Molecular Formula | C34H26N2O |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 4-[4-[6-(4-tert-butyl-2-pyridinyl)dibenzofuran-4-yl]phenyl]benzonitrile |
| SMILES | CC(C)(C)c1ccnc(-c2cccc3c2oc2c(-c4ccc(-c5ccc(C#N)cc5)cc4)cccc23)c1 |
| InChI | InChI=1S/C34H26N2O/c1-34(2,3)26-18-19-36-31(20-26)30-9-5-8-29-28-7-4-6-27(32(28)37-33(29)30)25-16-14-24(15-17-25)23-12-10-22(21-35)11-13-23/h4-20H,1-3H3 |
| InChIKey | GEXMFAQGVGEANP-UHFFFAOYSA-N |
| XLogP | 9.15 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |