C23H26N2OSi — CID 164796745
[8-(4-tert-butyl-2-pyridinyl)-[1]benzofuro[2,3-c]pyridin-5-yl]-trimethylsilane (PubChem CID 164796745) has the molecular formula C23H26N2OSi and a molecular weight of 374.56 g/mol. Its IUPAC name is [8-(4-tert-butyl-2-pyridinyl)-[1]benzofuro[2,3-c]pyridin-5-yl]-trimethylsilane.
| Compound Name | [8-(4-tert-butyl-2-pyridinyl)-[1]benzofuro[2,3-c]pyridin-5-yl]-trimethylsilane |
|---|---|
| PubChem CID | 164796745 |
| Molecular Formula | C23H26N2OSi |
| Molecular Weight | 374.56 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | [8-(4-tert-butyl-2-pyridinyl)-[1]benzofuro[2,3-c]pyridin-5-yl]-trimethylsilane |
| SMILES | CC(C)(C)c1ccnc(-c2ccc([Si](C)(C)C)c3c2oc2cnccc23)c1 |
| InChI | InChI=1S/C23H26N2OSi/c1-23(2,3)15-9-12-25-18(13-15)16-7-8-20(27(4,5)6)21-17-10-11-24-14-19(17)26-22(16)21/h7-14H,1-6H3 |
| InChIKey | RQFNFVJDFJQUJS-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.56 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|