C25H19NO — CID 162710303
4-[dideuterio(phenyl)methyl]-2-[7-(trideuteriomethyl)dibenzofuran-4-yl]pyridine (PubChem CID 162710303) has the molecular formula C25H19NO and a molecular weight of 354.46 g/mol. Its IUPAC name is 4-[dideuterio(phenyl)methyl]-2-[7-(trideuteriomethyl)dibenzofuran-4-yl]pyridine.
| Compound Name | 4-[dideuterio(phenyl)methyl]-2-[7-(trideuteriomethyl)dibenzofuran-4-yl]pyridine |
|---|---|
| PubChem CID | 162710303 |
| Molecular Formula | C25H19NO |
| Molecular Weight | 354.46 g/mol |
| Exact Mass | 354.18 |
| IUPAC Name | 4-[dideuterio(phenyl)methyl]-2-[7-(trideuteriomethyl)dibenzofuran-4-yl]pyridine |
| SMILES | [2H]C([2H])([2H])c1ccc2c(c1)oc1c(-c3cc(C([2H])([2H])c4ccccc4)ccn3)cccc12 |
| InChI | InChI=1S/C25H19NO/c1-17-10-11-20-21-8-5-9-22(25(21)27-24(20)14-17)23-16-19(12-13-26-23)15-18-6-3-2-4-7-18/h2-14,16H,15H2,1H3/i1D3,15D2 |
| InChIKey | KPUTXGCYZDTASO-GJZIZAJSSA-N |
| XLogP | 6.55 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.46 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |