C53H36N4O2 — CID 140881794
N,N-bis[3-([1]benzofuro[2,3-c]pyridin-3-yl)-5-phenylphenyl]-2,4-dimethylpyridin-3-amine (PubChem CID 140881794) has the molecular formula C53H36N4O2 and a molecular weight of 760.90 g/mol. Its IUPAC name is N,N-bis[3-([1]benzofuro[2,3-c]pyridin-3-yl)-5-phenylphenyl]-2,4-dimethylpyridin-3-amine.
| Compound Name | N,N-bis[3-([1]benzofuro[2,3-c]pyridin-3-yl)-5-phenylphenyl]-2,4-dimethylpyridin-3-amine |
|---|---|
| PubChem CID | 140881794 |
| Molecular Formula | C53H36N4O2 |
| Molecular Weight | 760.90 g/mol |
| Exact Mass | 760.28 |
| IUPAC Name | N,N-bis[3-([1]benzofuro[2,3-c]pyridin-3-yl)-5-phenylphenyl]-2,4-dimethylpyridin-3-amine |
| SMILES | Cc1ccnc(C)c1N(c1cc(-c2ccccc2)cc(-c2cc3c(cn2)oc2ccccc23)c1)c1cc(-c2ccccc2)cc(-c2cc3c(cn2)oc2ccccc23)c1 |
| InChI | InChI=1S/C53H36N4O2/c1-33-21-22-54-34(2)53(33)57(41-25-37(35-13-5-3-6-14-35)23-39(27-41)47-29-45-43-17-9-11-19-49(43)58-51(45)31-55-47)42-26-38(36-15-7-4-8-16-36)24-40(28-42)48-30-46-44-18-10-12-20-50(44)59-52(46)32-56-48/h3-32H,1-2H3 |
| InChIKey | UICCLOUHQBPXNR-UHFFFAOYSA-N |
| XLogP | 14.43 |
| TPSA | 68.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 760.90 |
| LogP ≤ 5 | 14.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |