C34H22N2O — CID 155079111
4-dibenzofuran-3-yl-6-(3,5-diphenylphenyl)pyrimidine (PubChem CID 155079111) has the molecular formula C34H22N2O and a molecular weight of 474.56 g/mol. Its IUPAC name is 4-dibenzofuran-3-yl-6-(3,5-diphenylphenyl)pyrimidine.
| Compound Name | 4-dibenzofuran-3-yl-6-(3,5-diphenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 155079111 |
| Molecular Formula | C34H22N2O |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | 4-dibenzofuran-3-yl-6-(3,5-diphenylphenyl)pyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3cc(-c4ccc5c(c4)oc4ccccc45)ncn3)c2)cc1 |
| InChI | InChI=1S/C34H22N2O/c1-3-9-23(10-4-1)26-17-27(24-11-5-2-6-12-24)19-28(18-26)32-21-31(35-22-36-32)25-15-16-30-29-13-7-8-14-33(29)37-34(30)20-25/h1-22H |
| InChIKey | LVHVNEXJBNOKRD-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |