C46H30N2O — CID 138659621
4-dibenzofuran-3-yl-6-[4-(3,5-diphenylphenyl)phenyl]-2-phenylpyrimidine (PubChem CID 138659621) has the molecular formula C46H30N2O and a molecular weight of 626.76 g/mol. Its IUPAC name is 4-dibenzofuran-3-yl-6-[4-(3,5-diphenylphenyl)phenyl]-2-phenylpyrimidine.
| Compound Name | 4-dibenzofuran-3-yl-6-[4-(3,5-diphenylphenyl)phenyl]-2-phenylpyrimidine |
|---|---|
| PubChem CID | 138659621 |
| Molecular Formula | C46H30N2O |
| Molecular Weight | 626.76 g/mol |
| Exact Mass | 626.24 |
| IUPAC Name | 4-dibenzofuran-3-yl-6-[4-(3,5-diphenylphenyl)phenyl]-2-phenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccccc3)cc(-c3ccc(-c4cc(-c5ccc6c(c5)oc5ccccc56)nc(-c5ccccc5)n4)cc3)c2)cc1 |
| InChI | InChI=1S/C46H30N2O/c1-4-12-31(13-5-1)37-26-38(32-14-6-2-7-15-32)28-39(27-37)33-20-22-34(23-21-33)42-30-43(48-46(47-42)35-16-8-3-9-17-35)36-24-25-41-40-18-10-11-19-44(40)49-45(41)29-36/h1-30H |
| InChIKey | BFYKIXHVFBGKGF-UHFFFAOYSA-N |
| XLogP | 12.38 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.76 |
| LogP ≤ 5 | 12.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |