C52H34N2O — CID 171583122
4-(3-dibenzofuran-3-yl-5-phenylphenyl)-2-(3,5-diphenylphenyl)-6-phenylpyrimidine (PubChem CID 171583122) has the molecular formula C52H34N2O and a molecular weight of 702.86 g/mol. Its IUPAC name is 4-(3-dibenzofuran-3-yl-5-phenylphenyl)-2-(3,5-diphenylphenyl)-6-phenylpyrimidine.
| Compound Name | 4-(3-dibenzofuran-3-yl-5-phenylphenyl)-2-(3,5-diphenylphenyl)-6-phenylpyrimidine |
|---|---|
| PubChem CID | 171583122 |
| Molecular Formula | C52H34N2O |
| Molecular Weight | 702.86 g/mol |
| Exact Mass | 702.27 |
| IUPAC Name | 4-(3-dibenzofuran-3-yl-5-phenylphenyl)-2-(3,5-diphenylphenyl)-6-phenylpyrimidine |
| SMILES | c1ccc(-c2cc(-c3ccc4c(c3)oc3ccccc34)cc(-c3cc(-c4ccccc4)nc(-c4cc(-c5ccccc5)cc(-c5ccccc5)c4)n3)c2)cc1 |
| InChI | InChI=1S/C52H34N2O/c1-5-15-35(16-6-1)40-28-43(39-25-26-47-46-23-13-14-24-50(46)55-51(47)33-39)30-44(29-40)49-34-48(38-21-11-4-12-22-38)53-52(54-49)45-31-41(36-17-7-2-8-18-36)27-42(32-45)37-19-9-3-10-20-37/h1-34H |
| InChIKey | PEUCMLGVPNNAEN-UHFFFAOYSA-N |
| XLogP | 14.05 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.86 |
| LogP ≤ 5 | 14.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |