C29H20N2O — CID 149371859
4-dibenzofuran-3-yl-2-methyl-6-(4-phenylphenyl)pyrimidine (PubChem CID 149371859) has the molecular formula C29H20N2O and a molecular weight of 412.49 g/mol. Its IUPAC name is 4-dibenzofuran-3-yl-2-methyl-6-(4-phenylphenyl)pyrimidine.
| Compound Name | 4-dibenzofuran-3-yl-2-methyl-6-(4-phenylphenyl)pyrimidine |
|---|---|
| PubChem CID | 149371859 |
| Molecular Formula | C29H20N2O |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | 4-dibenzofuran-3-yl-2-methyl-6-(4-phenylphenyl)pyrimidine |
| SMILES | Cc1nc(-c2ccc(-c3ccccc3)cc2)cc(-c2ccc3c(c2)oc2ccccc23)n1 |
| InChI | InChI=1S/C29H20N2O/c1-19-30-26(22-13-11-21(12-14-22)20-7-3-2-4-8-20)18-27(31-19)23-15-16-25-24-9-5-6-10-28(24)32-29(25)17-23/h2-18H,1H3 |
| InChIKey | YJYRKNFWYLBMIM-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |