C20H23BFN3O4 — CID 86281929
N-tert-butyl-N'-(7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-2,6-dimethylpyridine-4-carbohydrazide (PubChem CID 86281929) has the molecular formula C20H23BFN3O4 and a molecular weight of 399.23 g/mol. Its IUPAC name is N-tert-butyl-N'-(7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-2,6-dimethylpyridine-4-carbohydrazide.
| Compound Name | N-tert-butyl-N'-(7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-2,6-dimethylpyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 86281929 |
| Molecular Formula | C20H23BFN3O4 |
| Molecular Weight | 399.23 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | N-tert-butyl-N'-(7-fluoro-1-hydroxy-3H-2,1-benzoxaborole-6-carbonyl)-2,6-dimethylpyridine-4-carbohydrazide |
| SMILES | Cc1cc(C(=O)N(NC(=O)c2ccc3c(c2F)B(O)OC3)C(C)(C)C)cc(C)n1 |
| InChI | InChI=1S/C20H23BFN3O4/c1-11-8-14(9-12(2)23-11)19(27)25(20(3,4)5)24-18(26)15-7-6-13-10-29-21(28)16(13)17(15)22/h6-9,28H,10H2,1-5H3,(H,24,26) |
| InChIKey | WRVQSFAOTVSMRR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 91.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.23 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|