C21H21F3N2O4 — CID 129169383
[2-cyano-2-[[4-(trifluoromethoxy)benzoyl]amino]propyl] 1,2,3,4,5,6-hexahydropentalene-1-carboxylate (PubChem CID 129169383) has the molecular formula C21H21F3N2O4 and a molecular weight of 422.40 g/mol. Its IUPAC name is [2-cyano-2-[[4-(trifluoromethoxy)benzoyl]amino]propyl] 1,2,3,4,5,6-hexahydropentalene-1-carboxylate.
| Compound Name | [2-cyano-2-[[4-(trifluoromethoxy)benzoyl]amino]propyl] 1,2,3,4,5,6-hexahydropentalene-1-carboxylate |
|---|---|
| PubChem CID | 129169383 |
| Molecular Formula | C21H21F3N2O4 |
| Molecular Weight | 422.40 g/mol |
| Exact Mass | 422.15 |
| IUPAC Name | [2-cyano-2-[[4-(trifluoromethoxy)benzoyl]amino]propyl] 1,2,3,4,5,6-hexahydropentalene-1-carboxylate |
| SMILES | CC(C#N)(COC(=O)C1CCC2=C1CCC2)NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H21F3N2O4/c1-20(11-25,12-29-19(28)17-10-7-13-3-2-4-16(13)17)26-18(27)14-5-8-15(9-6-14)30-21(22,23)24/h5-6,8-9,17H,2-4,7,10,12H2,1H3,(H,26,27) |
| InChIKey | OOJTTYPIXMSLJW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.40 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|