C13H14Br2F3NO2 — CID 107868078
N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 107868078) has the molecular formula C13H14Br2F3NO2 and a molecular weight of 433.06 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 107868078 |
| Molecular Formula | C13H14Br2F3NO2 |
| Molecular Weight | 433.06 g/mol |
| Exact Mass | 430.93 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | CCC(CBr)(CBr)NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H14Br2F3NO2/c1-2-12(7-14,8-15)19-11(20)9-3-5-10(6-4-9)21-13(16,17)18/h3-6H,2,7-8H2,1H3,(H,19,20) |
| InChIKey | XHIKPPUOPUJZDN-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.06 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|