C13H16F3NO4 — CID 103602335
N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-(trifluoromethoxy)benzamide (PubChem CID 103602335) has the molecular formula C13H16F3NO4 and a molecular weight of 307.27 g/mol. Its IUPAC name is N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-(trifluoromethoxy)benzamide.
| Compound Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-(trifluoromethoxy)benzamide |
|---|---|
| PubChem CID | 103602335 |
| Molecular Formula | C13H16F3NO4 |
| Molecular Weight | 307.27 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[1-hydroxy-2-(hydroxymethyl)butan-2-yl]-4-(trifluoromethoxy)benzamide |
| SMILES | CCC(CO)(CO)NC(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3NO4/c1-2-12(7-18,8-19)17-11(20)9-3-5-10(6-4-9)21-13(14,15)16/h3-6,18-19H,2,7-8H2,1H3,(H,17,20) |
| InChIKey | UQQPXXYDVXJXAC-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.27 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |