C18H19F3N2O4S — CID 129169234
[2-cyano-2-[[4-(trifluoromethylsulfinyl)benzoyl]amino]propyl] cyclopentanecarboxylate (PubChem CID 129169234) has the molecular formula C18H19F3N2O4S and a molecular weight of 416.42 g/mol. Its IUPAC name is [2-cyano-2-[[4-(trifluoromethylsulfinyl)benzoyl]amino]propyl] cyclopentanecarboxylate.
| Compound Name | [2-cyano-2-[[4-(trifluoromethylsulfinyl)benzoyl]amino]propyl] cyclopentanecarboxylate |
|---|---|
| PubChem CID | 129169234 |
| Molecular Formula | C18H19F3N2O4S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | [2-cyano-2-[[4-(trifluoromethylsulfinyl)benzoyl]amino]propyl] cyclopentanecarboxylate |
| SMILES | CC(C#N)(COC(=O)C1CCCC1)NC(=O)c1ccc(S(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H19F3N2O4S/c1-17(10-22,11-27-16(25)13-4-2-3-5-13)23-15(24)12-6-8-14(9-7-12)28(26)18(19,20)21/h6-9,13H,2-5,11H2,1H3,(H,23,24) |
| InChIKey | ICHJPCCUONERBC-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |