C21H17F6N3O3S — CID 129146733
N-[2-cyano-1-[(2Z,4Z)-6-cyano-3-(trifluoromethyl)hepta-2,4,6-trien-2-yl]oxypropan-2-yl]-4-[(R)-trifluoromethylsulfinyl]benzamide (PubChem CID 129146733) has the molecular formula C21H17F6N3O3S and a molecular weight of 505.44 g/mol. Its IUPAC name is N-[2-cyano-1-[(2Z,4Z)-6-cyano-3-(trifluoromethyl)hepta-2,4,6-trien-2-yl]oxypropan-2-yl]-4-[(R)-trifluoromethylsulfinyl]benzamide.
| Compound Name | N-[2-cyano-1-[(2Z,4Z)-6-cyano-3-(trifluoromethyl)hepta-2,4,6-trien-2-yl]oxypropan-2-yl]-4-[(R)-trifluoromethylsulfinyl]benzamide |
|---|---|
| PubChem CID | 129146733 |
| Molecular Formula | C21H17F6N3O3S |
| Molecular Weight | 505.44 g/mol |
| Exact Mass | 505.09 |
| IUPAC Name | N-[2-cyano-1-[(2Z,4Z)-6-cyano-3-(trifluoromethyl)hepta-2,4,6-trien-2-yl]oxypropan-2-yl]-4-[(R)-trifluoromethylsulfinyl]benzamide |
| SMILES | C=C(C#N)/C=C\C(=C(/C)OCC(C)(C#N)NC(=O)c1ccc([S@@](=O)C(F)(F)F)cc1)C(F)(F)F |
| InChI | InChI=1S/C21H17F6N3O3S/c1-13(10-28)4-9-17(20(22,23)24)14(2)33-12-19(3,11-29)30-18(31)15-5-7-16(8-6-15)34(32)21(25,26)27/h4-9H,1,12H2,2-3H3,(H,30,31)/b9-4-,17-14-/t19?,34-/m1/s1 |
| InChIKey | KAGAMQJCFXCUBB-ZLVBUETASA-N |
| XLogP | 4.81 |
| TPSA | 102.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|