C20H13F6N3O2S — CID 89428365
N-[(2S)-2-cyano-1-(3-cyano-2,4,5-trifluoro-6-methylphenoxy)propan-2-yl]-4-(trifluoromethylsulfanyl)benzamide (PubChem CID 89428365) has the molecular formula C20H13F6N3O2S and a molecular weight of 473.40 g/mol. Its IUPAC name is N-[(2S)-2-cyano-1-(3-cyano-2,4,5-trifluoro-6-methylphenoxy)propan-2-yl]-4-(trifluoromethylsulfanyl)benzamide.
| Compound Name | N-[(2S)-2-cyano-1-(3-cyano-2,4,5-trifluoro-6-methylphenoxy)propan-2-yl]-4-(trifluoromethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 89428365 |
| Molecular Formula | C20H13F6N3O2S |
| Molecular Weight | 473.40 g/mol |
| Exact Mass | 473.06 |
| IUPAC Name | N-[(2S)-2-cyano-1-(3-cyano-2,4,5-trifluoro-6-methylphenoxy)propan-2-yl]-4-(trifluoromethylsulfanyl)benzamide |
| SMILES | Cc1c(F)c(F)c(C#N)c(F)c1OC[C@](C)(C#N)NC(=O)c1ccc(SC(F)(F)F)cc1 |
| InChI | InChI=1S/C20H13F6N3O2S/c1-10-14(21)15(22)13(7-27)16(23)17(10)31-9-19(2,8-28)29-18(30)11-3-5-12(6-4-11)32-20(24,25)26/h3-6H,9H2,1-2H3,(H,29,30)/t19-/m0/s1 |
| InChIKey | JPAWDXRIKDVJKX-IBGZPJMESA-N |
| XLogP | 4.99 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|