About 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea
1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea (PubChem CID 144875128) has the molecular formula C10H12BN3O2S
and a molecular weight of 249.10 g/mol. Its IUPAC name is 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea.
Molecular Properties
| Compound Name | 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea |
| PubChem CID | 144875128 |
| Molecular Formula | C10H12BN3O2S |
| Molecular Weight | 249.10 g/mol |
| Exact Mass | 249.07 |
| IUPAC Name | 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C/c1cccc2c1B(O)OC2 |
| InChI | InChI=1S/C10H12BN3O2S/c1-12-10(17)14-13-5-7-3-2-4-8-6-16-11(15)9(7)8/h2-5,15H,6H2,1H3,(H2,12,14,17)/b13-5+ |
| InChIKey | SBMUHIBGTWAKKJ-WLRTZDKTSA-N |
| XLogP | -0.67 |
| TPSA | 65.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.10 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea?
The IUPAC name of 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea (CID 144875128) is 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea.
What is the SMILES notation for 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea?
The canonical SMILES for 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea is CNC(=S)N/N=C/c1cccc2c1B(O)OC2.
What is the InChIKey of 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea?
The InChIKey is SBMUHIBGTWAKKJ-WLRTZDKTSA-N. The full InChI is InChI=1S/C10H12BN3O2S/c1-12-10(17)14-13-5-7-3-2-4-8-6-16-11(15)9(7)8/h2-5,15H,6H2,1H3,(H2,12,14,17)/b13-5+.
What are the key properties of 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea?
1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea has a molecular weight of 249.10 g/mol, XLogP of -0.67, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(E)-(1-hydroxy-3H-2,1-benzoxaborol-7-yl)methylideneamino]-3-methylthiourea is sourced from PubChem (CID 144875128), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).