C9H10BrN3OS — CID 135533445
1-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-3-methylthiourea (PubChem CID 135533445) has the molecular formula C9H10BrN3OS and a molecular weight of 288.17 g/mol. Its IUPAC name is 1-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 135533445 |
| Molecular Formula | C9H10BrN3OS |
| Molecular Weight | 288.17 g/mol |
| Exact Mass | 286.97 |
| IUPAC Name | 1-[(E)-(5-bromo-2-hydroxyphenyl)methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C/c1cc(Br)ccc1O |
| InChI | InChI=1S/C9H10BrN3OS/c1-11-9(15)13-12-5-6-4-7(10)2-3-8(6)14/h2-5,14H,1H3,(H2,11,13,15)/b12-5+ |
| InChIKey | IZDNDUPFWQMKEB-LFYBBSHMSA-N |
| XLogP | 1.58 |
| TPSA | 56.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.17 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|