C11H15N3S — CID 2401297
1-[(2,5-dimethylphenyl)methylideneamino]-3-methylthiourea (PubChem CID 2401297) has the molecular formula C11H15N3S and a molecular weight of 221.33 g/mol. Its IUPAC name is 1-[(2,5-dimethylphenyl)methylideneamino]-3-methylthiourea.
| Compound Name | 1-[(2,5-dimethylphenyl)methylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 2401297 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 1-[(2,5-dimethylphenyl)methylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)NN=Cc1cc(C)ccc1C |
| InChI | InChI=1S/C11H15N3S/c1-8-4-5-9(2)10(6-8)7-13-14-11(15)12-3/h4-7H,1-3H3,(H2,12,14,15) |
| InChIKey | VPABNWUNKSLUBY-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|