C7H9N3OS — CID 5423286
1-[(Z)-furan-2-ylmethylideneamino]-3-methylthiourea (PubChem CID 5423286) has the molecular formula C7H9N3OS and a molecular weight of 183.24 g/mol. Its IUPAC name is 1-[(Z)-furan-2-ylmethylideneamino]-3-methylthiourea.
| Compound Name | 1-[(Z)-furan-2-ylmethylideneamino]-3-methylthiourea |
|---|---|
| PubChem CID | 5423286 |
| Molecular Formula | C7H9N3OS |
| Molecular Weight | 183.24 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 1-[(Z)-furan-2-ylmethylideneamino]-3-methylthiourea |
| SMILES | CNC(=S)N/N=C\c1ccco1 |
| InChI | InChI=1S/C7H9N3OS/c1-8-7(12)10-9-5-6-3-2-4-11-6/h2-5H,1H3,(H2,8,10,12)/b9-5- |
| InChIKey | HYXWOVSEEKCMOC-UITAMQMPSA-N |
| XLogP | 0.71 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.24 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|