About ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate
ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate (PubChem CID 110778029) has the molecular formula C12H15NO4
and a molecular weight of 237.25 g/mol. Its IUPAC name is ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate.
Analyze ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate?
The IUPAC name of ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate (CID 110778029) is ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate.
What is the SMILES notation for ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate?
The canonical SMILES for ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate is CCOC(=O)Nc1cc2c(cc1C)OCCO2.
What is the InChIKey of ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate?
The InChIKey is RISBGJFUDHDYHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO4/c1-3-15-12(14)13-9-7-11-10(6-8(9)2)16-4-5-17-11/h6-7H,3-5H2,1-2H3,(H,13,14).
What are the key properties of ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate?
ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate has a molecular weight of 237.25 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamate is sourced from PubChem (CID 110778029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).