C13H13N3O5 — CID 168521958
ethyl N-[6-[(2-cyanoacetyl)amino]-1,3-benzodioxol-5-yl]carbamate (PubChem CID 168521958) has the molecular formula C13H13N3O5 and a molecular weight of 291.26 g/mol. Its IUPAC name is ethyl N-[6-[(2-cyanoacetyl)amino]-1,3-benzodioxol-5-yl]carbamate.
| Compound Name | ethyl N-[6-[(2-cyanoacetyl)amino]-1,3-benzodioxol-5-yl]carbamate |
|---|---|
| PubChem CID | 168521958 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | ethyl N-[6-[(2-cyanoacetyl)amino]-1,3-benzodioxol-5-yl]carbamate |
| SMILES | CCOC(=O)Nc1cc2c(cc1NC(=O)CC#N)OCO2 |
| InChI | InChI=1S/C13H13N3O5/c1-2-19-13(18)16-9-6-11-10(20-7-21-11)5-8(9)15-12(17)3-4-14/h5-6H,2-3,7H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | WZEICZRDYCJCFW-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 109.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |