C10H10BrNO3 — CID 115193287
N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamoyl bromide (PubChem CID 115193287) has the molecular formula C10H10BrNO3 and a molecular weight of 272.10 g/mol. Its IUPAC name is N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamoyl bromide.
| Compound Name | N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamoyl bromide |
|---|---|
| PubChem CID | 115193287 |
| Molecular Formula | C10H10BrNO3 |
| Molecular Weight | 272.10 g/mol |
| Exact Mass | 270.98 |
| IUPAC Name | N-(7-methyl-2,3-dihydro-1,4-benzodioxin-6-yl)carbamoyl bromide |
| SMILES | Cc1cc2c(cc1NC(=O)Br)OCCO2 |
| InChI | InChI=1S/C10H10BrNO3/c1-6-4-8-9(15-3-2-14-8)5-7(6)12-10(11)13/h4-5H,2-3H2,1H3,(H,12,13) |
| InChIKey | BUXOIAWYLYDZBV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.10 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|