C10H14N2O5S — CID 21407680
2-amino-4-(ethoxycarbonylamino)-5-methylbenzenesulfonic acid (PubChem CID 21407680) has the molecular formula C10H14N2O5S and a molecular weight of 274.30 g/mol. Its IUPAC name is 2-amino-4-(ethoxycarbonylamino)-5-methylbenzenesulfonic acid.
| Compound Name | 2-amino-4-(ethoxycarbonylamino)-5-methylbenzenesulfonic acid |
|---|---|
| PubChem CID | 21407680 |
| Molecular Formula | C10H14N2O5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.06 |
| IUPAC Name | 2-amino-4-(ethoxycarbonylamino)-5-methylbenzenesulfonic acid |
| SMILES | CCOC(=O)Nc1cc(N)c(S(=O)(=O)O)cc1C |
| InChI | InChI=1S/C10H14N2O5S/c1-3-17-10(13)12-8-5-7(11)9(4-6(8)2)18(14,15)16/h4-5H,3,11H2,1-2H3,(H,12,13)(H,14,15,16) |
| InChIKey | QKOVRBPJHNQFPY-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 118.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|