C13H12NNaO6S — CID 170847136
sodium 8-(ethoxycarbonylamino)-6-sulfonaphthalen-2-olate (PubChem CID 170847136) has the molecular formula C13H12NNaO6S and a molecular weight of 333.30 g/mol. Its IUPAC name is sodium 8-(ethoxycarbonylamino)-6-sulfonaphthalen-2-olate.
| Compound Name | sodium 8-(ethoxycarbonylamino)-6-sulfonaphthalen-2-olate |
|---|---|
| PubChem CID | 170847136 |
| Molecular Formula | C13H12NNaO6S |
| Molecular Weight | 333.30 g/mol |
| Exact Mass | 333.03 |
| IUPAC Name | sodium 8-(ethoxycarbonylamino)-6-sulfonaphthalen-2-olate |
| SMILES | CCOC(=O)Nc1cc(S(=O)(=O)O)cc2ccc([O-])cc12.[Na+] |
| InChI | InChI=1S/C13H13NO6S.Na/c1-2-20-13(16)14-12-7-10(21(17,18)19)5-8-3-4-9(15)6-11(8)12;/h3-7,15H,2H2,1H3,(H,14,16)(H,17,18,19);/q;+1/p-1 |
| InChIKey | PBUGBPLPKPGFSY-UHFFFAOYSA-M |
| XLogP | -1.27 |
| TPSA | 115.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.30 |
| LogP ≤ 5 | -1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|