C15H24N3O5S+ — CID 9081620
ethyl N-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]carbamate (PubChem CID 9081620) has the molecular formula C15H24N3O5S+ and a molecular weight of 358.44 g/mol. Its IUPAC name is ethyl N-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]carbamate.
| Compound Name | ethyl N-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]carbamate |
|---|---|
| PubChem CID | 9081620 |
| Molecular Formula | C15H24N3O5S+ |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | ethyl N-[2-methoxy-5-(4-methylpiperazin-4-ium-1-yl)sulfonylphenyl]carbamate |
| SMILES | CCOC(=O)Nc1cc(S(=O)(=O)N2CC[NH+](C)CC2)ccc1OC |
| InChI | InChI=1S/C15H23N3O5S/c1-4-23-15(19)16-13-11-12(5-6-14(13)22-3)24(20,21)18-9-7-17(2)8-10-18/h5-6,11H,4,7-10H2,1-3H3,(H,16,19)/p+1 |
| InChIKey | KWJHREFZJPIEMK-UHFFFAOYSA-O |
| XLogP | -0.22 |
| TPSA | 89.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |